C12H11F3O4S — CID 11243752
(7-methoxy-3,4-dihydronaphthalen-1-yl) trifluoromethanesulfonate (PubChem CID 11243752) has the molecular formula C12H11F3O4S and a molecular weight of 308.28 g/mol. Its IUPAC name is (7-methoxy-3,4-dihydronaphthalen-1-yl) trifluoromethanesulfonate.
| Compound Name | (7-methoxy-3,4-dihydronaphthalen-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11243752 |
| Molecular Formula | C12H11F3O4S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | (7-methoxy-3,4-dihydronaphthalen-1-yl) trifluoromethanesulfonate |
| SMILES | COc1ccc2c(c1)C(OS(=O)(=O)C(F)(F)F)=CCC2 |
| InChI | InChI=1S/C12H11F3O4S/c1-18-9-6-5-8-3-2-4-11(10(8)7-9)19-20(16,17)12(13,14)15/h4-7H,2-3H2,1H3 |
| InChIKey | NFDMYSLNTNONFR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|