C12H11NO — CID 11521201
7-methoxy-3,4-dihydronaphthalene-1-carbonitrile (PubChem CID 11521201) has the molecular formula C12H11NO and a molecular weight of 185.23 g/mol. Its IUPAC name is 7-methoxy-3,4-dihydronaphthalene-1-carbonitrile.
| Compound Name | 7-methoxy-3,4-dihydronaphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 11521201 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 7-methoxy-3,4-dihydronaphthalene-1-carbonitrile |
| SMILES | COc1ccc2c(c1)C(C#N)=CCC2 |
| InChI | InChI=1S/C12H11NO/c1-14-11-6-5-9-3-2-4-10(8-13)12(9)7-11/h4-7H,2-3H2,1H3 |
| InChIKey | IBAXOSUDTXPJSA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |