C11H10N2O — CID 123990064
7-methoxy-1,2-dihydroquinoline-4-carbonitrile (PubChem CID 123990064) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is 7-methoxy-1,2-dihydroquinoline-4-carbonitrile.
| Compound Name | 7-methoxy-1,2-dihydroquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 123990064 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 7-methoxy-1,2-dihydroquinoline-4-carbonitrile |
| SMILES | COc1ccc2c(c1)NCC=C2C#N |
| InChI | InChI=1S/C11H10N2O/c1-14-9-2-3-10-8(7-12)4-5-13-11(10)6-9/h2-4,6,13H,5H2,1H3 |
| InChIKey | HXCVCXDPFYGJNS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |