C8H9NO2S — CID 67694889
5-methoxy-2,3-dihydro-1,3-benzothiazole 1-oxide (PubChem CID 67694889) has the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. Its IUPAC name is 5-methoxy-2,3-dihydro-1,3-benzothiazole 1-oxide.
| Compound Name | 5-methoxy-2,3-dihydro-1,3-benzothiazole 1-oxide |
|---|---|
| PubChem CID | 67694889 |
| Molecular Formula | C8H9NO2S |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | 5-methoxy-2,3-dihydro-1,3-benzothiazole 1-oxide |
| SMILES | COc1ccc2c(c1)NCS2=O |
| InChI | InChI=1S/C8H9NO2S/c1-11-6-2-3-8-7(4-6)9-5-12(8)10/h2-4,9H,5H2,1H3 |
| InChIKey | JXTKCSNQRPJVKX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |