About 5-methoxy-2,3-dihydro-1,3-benzothiazole 1-oxide
5-methoxy-2,3-dihydro-1,3-benzothiazole 1-oxide (PubChem CID 67694889) has the molecular formula C8H9NO2S
and a molecular weight of 183.23 g/mol. Its IUPAC name is 5-methoxy-2,3-dihydro-1,3-benzothiazole 1-oxide.
Molecular Properties
| Compound Name | 5-methoxy-2,3-dihydro-1,3-benzothiazole 1-oxide |
| PubChem CID | 67694889 |
| Molecular Formula | C8H9NO2S |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | 5-methoxy-2,3-dihydro-1,3-benzothiazole 1-oxide |
| SMILES | COc1ccc2c(c1)NCS2=O |
| InChI | InChI=1S/C8H9NO2S/c1-11-6-2-3-8-7(4-6)9-5-12(8)10/h2-4,9H,5H2,1H3 |
| InChIKey | JXTKCSNQRPJVKX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-2,3-dihydro-1,3-benzothiazole 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2,3-dihydro-1,3-benzothiazole 1-oxide?
The IUPAC name of 5-methoxy-2,3-dihydro-1,3-benzothiazole 1-oxide (CID 67694889) is 5-methoxy-2,3-dihydro-1,3-benzothiazole 1-oxide.
What is the SMILES notation for 5-methoxy-2,3-dihydro-1,3-benzothiazole 1-oxide?
The canonical SMILES for 5-methoxy-2,3-dihydro-1,3-benzothiazole 1-oxide is COc1ccc2c(c1)NCS2=O.
What is the InChIKey of 5-methoxy-2,3-dihydro-1,3-benzothiazole 1-oxide?
The InChIKey is JXTKCSNQRPJVKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2S/c1-11-6-2-3-8-7(4-6)9-5-12(8)10/h2-4,9H,5H2,1H3.
What are the key properties of 5-methoxy-2,3-dihydro-1,3-benzothiazole 1-oxide?
5-methoxy-2,3-dihydro-1,3-benzothiazole 1-oxide has a molecular weight of 183.23 g/mol, XLogP of 1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2,3-dihydro-1,3-benzothiazole 1-oxide is sourced from PubChem (CID 67694889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).