C8H7NO2S — CID 139606231
5-methoxy-1,3-benzothiazole 1-oxide (PubChem CID 139606231) has the molecular formula C8H7NO2S and a molecular weight of 181.22 g/mol. Its IUPAC name is 5-methoxy-1,3-benzothiazole 1-oxide.
| Compound Name | 5-methoxy-1,3-benzothiazole 1-oxide |
|---|---|
| PubChem CID | 139606231 |
| Molecular Formula | C8H7NO2S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 5-methoxy-1,3-benzothiazole 1-oxide |
| SMILES | COc1ccc2c(c1)N=CS2=O |
| InChI | InChI=1S/C8H7NO2S/c1-11-6-2-3-8-7(4-6)9-5-12(8)10/h2-5H,1H3 |
| InChIKey | FRCSCYPTWREXJE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |