C11H14N2OS — CID 87090554
(3S)-7-methoxy-3-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepine-2-thione (PubChem CID 87090554) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is (3S)-7-methoxy-3-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepine-2-thione.
| Compound Name | (3S)-7-methoxy-3-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepine-2-thione |
|---|---|
| PubChem CID | 87090554 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | (3S)-7-methoxy-3-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepine-2-thione |
| SMILES | COc1ccc2c(c1)NC[C@H](C)C(=S)N2 |
| InChI | InChI=1S/C11H14N2OS/c1-7-6-12-10-5-8(14-2)3-4-9(10)13-11(7)15/h3-5,7,12H,6H2,1-2H3,(H,13,15)/t7-/m0/s1 |
| InChIKey | OZIDEDOFVMSUKI-ZETCQYMHSA-N |
| XLogP | 2.50 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|