C11H14N2O2 — CID 83217347
7-methoxy-3-methyl-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one (PubChem CID 83217347) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 7-methoxy-3-methyl-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one.
| Compound Name | 7-methoxy-3-methyl-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one |
|---|---|
| PubChem CID | 83217347 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 7-methoxy-3-methyl-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one |
| SMILES | COc1ccc2c(c1)C(=O)NC(C)CN2 |
| InChI | InChI=1S/C11H14N2O2/c1-7-6-12-10-4-3-8(15-2)5-9(10)11(14)13-7/h3-5,7,12H,6H2,1-2H3,(H,13,14) |
| InChIKey | ZTCNUJZEYRVACX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|