C11H11NO3 — CID 139792157
7-methoxy-1,2-dihydro-1-benzazepine-3,5-dione (PubChem CID 139792157) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 7-methoxy-1,2-dihydro-1-benzazepine-3,5-dione.
| Compound Name | 7-methoxy-1,2-dihydro-1-benzazepine-3,5-dione |
|---|---|
| PubChem CID | 139792157 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 7-methoxy-1,2-dihydro-1-benzazepine-3,5-dione |
| SMILES | COc1ccc2c(c1)C(=O)CC(=O)CN2 |
| InChI | InChI=1S/C11H11NO3/c1-15-8-2-3-10-9(5-8)11(14)4-7(13)6-12-10/h2-3,5,12H,4,6H2,1H3 |
| InChIKey | OBQBBJDBJMOWNS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|