C9H10N2O2 — CID 58200875
6-methoxy-2,4-dihydro-1H-1,5-naphthyridin-3-one (PubChem CID 58200875) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 6-methoxy-2,4-dihydro-1H-1,5-naphthyridin-3-one.
| Compound Name | 6-methoxy-2,4-dihydro-1H-1,5-naphthyridin-3-one |
|---|---|
| PubChem CID | 58200875 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 6-methoxy-2,4-dihydro-1H-1,5-naphthyridin-3-one |
| SMILES | COc1ccc2c(n1)CC(=O)CN2 |
| InChI | InChI=1S/C9H10N2O2/c1-13-9-3-2-7-8(11-9)4-6(12)5-10-7/h2-3,10H,4-5H2,1H3 |
| InChIKey | ZWXPLOZMTPOLDV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |