C10H15N3O — CID 115323647
4-ethyl-6-methoxy-2,3-dihydro-1H-pyrido[2,3-b]pyrazine (PubChem CID 115323647) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-ethyl-6-methoxy-2,3-dihydro-1H-pyrido[2,3-b]pyrazine.
| Compound Name | 4-ethyl-6-methoxy-2,3-dihydro-1H-pyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 115323647 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 4-ethyl-6-methoxy-2,3-dihydro-1H-pyrido[2,3-b]pyrazine |
| SMILES | CCN1CCNc2ccc(OC)nc21 |
| InChI | InChI=1S/C10H15N3O/c1-3-13-7-6-11-8-4-5-9(14-2)12-10(8)13/h4-5,11H,3,6-7H2,1-2H3 |
| InChIKey | RLWNFNBUIKOPIQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |