C11H13N3O3 — CID 67263507
4-ethyl-8-nitro-2,3-dihydro-1H-1,4-benzodiazepin-5-one (PubChem CID 67263507) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 4-ethyl-8-nitro-2,3-dihydro-1H-1,4-benzodiazepin-5-one.
| Compound Name | 4-ethyl-8-nitro-2,3-dihydro-1H-1,4-benzodiazepin-5-one |
|---|---|
| PubChem CID | 67263507 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-ethyl-8-nitro-2,3-dihydro-1H-1,4-benzodiazepin-5-one |
| SMILES | CCN1CCNc2cc([N+](=O)[O-])ccc2C1=O |
| InChI | InChI=1S/C11H13N3O3/c1-2-13-6-5-12-10-7-8(14(16)17)3-4-9(10)11(13)15/h3-4,7,12H,2,5-6H2,1H3 |
| InChIKey | JXJUDSLIMAFPNC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|