C24H23N3O6 — CID 170913962
12-[(3,4-dimethoxyphenyl)methyl]-5-nitro-2-oxa-9,12-diazatricyclo[12.4.0.03,8]octadeca-1(18),3(8),4,6,14,16-hexaen-13-one (PubChem CID 170913962) has the molecular formula C24H23N3O6 and a molecular weight of 449.46 g/mol. Its IUPAC name is 12-[(3,4-dimethoxyphenyl)methyl]-5-nitro-2-oxa-9,12-diazatricyclo[12.4.0.03,8]octadeca-1(18),3(8),4,6,14,16-hexaen-13-one.
| Compound Name | 12-[(3,4-dimethoxyphenyl)methyl]-5-nitro-2-oxa-9,12-diazatricyclo[12.4.0.03,8]octadeca-1(18),3(8),4,6,14,16-hexaen-13-one |
|---|---|
| PubChem CID | 170913962 |
| Molecular Formula | C24H23N3O6 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 12-[(3,4-dimethoxyphenyl)methyl]-5-nitro-2-oxa-9,12-diazatricyclo[12.4.0.03,8]octadeca-1(18),3(8),4,6,14,16-hexaen-13-one |
| SMILES | COc1ccc(CN2CCNc3ccc([N+](=O)[O-])cc3Oc3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/C24H23N3O6/c1-31-21-10-7-16(13-23(21)32-2)15-26-12-11-25-19-9-8-17(27(29)30)14-22(19)33-20-6-4-3-5-18(20)24(26)28/h3-10,13-14,25H,11-12,15H2,1-2H3 |
| InChIKey | HSHKLMJLRMCARF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|