C17H20ClN3O3 — CID 119921238
1-[(2-methoxy-5-nitrophenyl)methyl]-2,3,4,5-tetrahydro-1,4-benzodiazepine;hydrochloride (PubChem CID 119921238) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is 1-[(2-methoxy-5-nitrophenyl)methyl]-2,3,4,5-tetrahydro-1,4-benzodiazepine;hydrochloride.
| Compound Name | 1-[(2-methoxy-5-nitrophenyl)methyl]-2,3,4,5-tetrahydro-1,4-benzodiazepine;hydrochloride |
|---|---|
| PubChem CID | 119921238 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 1-[(2-methoxy-5-nitrophenyl)methyl]-2,3,4,5-tetrahydro-1,4-benzodiazepine;hydrochloride |
| SMILES | COc1ccc([N+](=O)[O-])cc1CN1CCNCc2ccccc21.Cl |
| InChI | InChI=1S/C17H19N3O3.ClH/c1-23-17-7-6-15(20(21)22)10-14(17)12-19-9-8-18-11-13-4-2-3-5-16(13)19;/h2-7,10,18H,8-9,11-12H2,1H3;1H |
| InChIKey | TVOBLSYQDDHLFO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|