C19H24ClN3O4 — CID 120753678
1-[(2-methoxy-5-nitrophenyl)methyl]-2-(2-methoxyphenyl)piperazine;hydrochloride (PubChem CID 120753678) has the molecular formula C19H24ClN3O4 and a molecular weight of 393.87 g/mol. Its IUPAC name is 1-[(2-methoxy-5-nitrophenyl)methyl]-2-(2-methoxyphenyl)piperazine;hydrochloride.
| Compound Name | 1-[(2-methoxy-5-nitrophenyl)methyl]-2-(2-methoxyphenyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120753678 |
| Molecular Formula | C19H24ClN3O4 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 1-[(2-methoxy-5-nitrophenyl)methyl]-2-(2-methoxyphenyl)piperazine;hydrochloride |
| SMILES | COc1ccc([N+](=O)[O-])cc1CN1CCNCC1c1ccccc1OC.Cl |
| InChI | InChI=1S/C19H23N3O4.ClH/c1-25-18-8-7-15(22(23)24)11-14(18)13-21-10-9-20-12-17(21)16-5-3-4-6-19(16)26-2;/h3-8,11,17,20H,9-10,12-13H2,1-2H3;1H |
| InChIKey | LEPSLSLUFTWPOG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|