C10H11N3O3 — CID 67263833
4-methyl-8-nitro-3,5-dihydro-1H-1,4-benzodiazepin-2-one (PubChem CID 67263833) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is 4-methyl-8-nitro-3,5-dihydro-1H-1,4-benzodiazepin-2-one.
| Compound Name | 4-methyl-8-nitro-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 67263833 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 4-methyl-8-nitro-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
| SMILES | CN1CC(=O)Nc2cc([N+](=O)[O-])ccc2C1 |
| InChI | InChI=1S/C10H11N3O3/c1-12-5-7-2-3-8(13(15)16)4-9(7)11-10(14)6-12/h2-4H,5-6H2,1H3,(H,11,14) |
| InChIKey | SEOZLKMQTFPMMA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|