C10H13N3O2 — CID 175069534
6-nitro-2-propan-2-yl-1,3-dihydroindazole (PubChem CID 175069534) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 6-nitro-2-propan-2-yl-1,3-dihydroindazole.
| Compound Name | 6-nitro-2-propan-2-yl-1,3-dihydroindazole |
|---|---|
| PubChem CID | 175069534 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 6-nitro-2-propan-2-yl-1,3-dihydroindazole |
| SMILES | CC(C)N1Cc2ccc([N+](=O)[O-])cc2N1 |
| InChI | InChI=1S/C10H13N3O2/c1-7(2)12-6-8-3-4-9(13(14)15)5-10(8)11-12/h3-5,7,11H,6H2,1-2H3 |
| InChIKey | FZIFLTYPJJLZJV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|