C10H10N2O4 — CID 175121181
4-methyl-8-nitro-5H-1,4-benzoxazepin-3-one (PubChem CID 175121181) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is 4-methyl-8-nitro-5H-1,4-benzoxazepin-3-one.
| Compound Name | 4-methyl-8-nitro-5H-1,4-benzoxazepin-3-one |
|---|---|
| PubChem CID | 175121181 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 4-methyl-8-nitro-5H-1,4-benzoxazepin-3-one |
| SMILES | CN1Cc2ccc([N+](=O)[O-])cc2OCC1=O |
| InChI | InChI=1S/C10H10N2O4/c1-11-5-7-2-3-8(12(14)15)4-9(7)16-6-10(11)13/h2-4H,5-6H2,1H3 |
| InChIKey | LMKJEQMPFULEFW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|