C10H7N3O4 — CID 14402878
2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetonitrile (PubChem CID 14402878) has the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. Its IUPAC name is 2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetonitrile.
| Compound Name | 2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetonitrile |
|---|---|
| PubChem CID | 14402878 |
| Molecular Formula | C10H7N3O4 |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 2-(6-nitro-3-oxo-1,4-benzoxazin-4-yl)acetonitrile |
| SMILES | N#CCN1C(=O)COc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C10H7N3O4/c11-3-4-12-8-5-7(13(15)16)1-2-9(8)17-6-10(12)14/h1-2,5H,4,6H2 |
| InChIKey | IFVQRNCOIKVVLL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 96.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|