C12H12N2O6 — CID 82142713
2-(7-nitro-3-oxo-1,4-benzoxazin-4-yl)butanoic acid (PubChem CID 82142713) has the molecular formula C12H12N2O6 and a molecular weight of 280.24 g/mol. Its IUPAC name is 2-(7-nitro-3-oxo-1,4-benzoxazin-4-yl)butanoic acid.
| Compound Name | 2-(7-nitro-3-oxo-1,4-benzoxazin-4-yl)butanoic acid |
|---|---|
| PubChem CID | 82142713 |
| Molecular Formula | C12H12N2O6 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-(7-nitro-3-oxo-1,4-benzoxazin-4-yl)butanoic acid |
| SMILES | CCC(C(=O)O)N1C(=O)COc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C12H12N2O6/c1-2-8(12(16)17)13-9-4-3-7(14(18)19)5-10(9)20-6-11(13)15/h3-5,8H,2,6H2,1H3,(H,16,17) |
| InChIKey | WCCVZDDKPZTEIP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|