2-(5-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid

C12H14N2O4 — CID 82346034

IUPAC2-(5-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid
SMILESCCC(C(=O)O)N1C(=O)COc2cccc(N)c21
InChIInChI=1S/C12H14N2O4/c1-2-8(12(16)17)14-10(15)6-18-9-5-3-4-7(13)11(9)14/h3-5,8H,2,6,13H2,1H3,(H,16,17)
InChIKeyAMVJGTBONOBGNZ-UHFFFAOYSA-N
MW250.25 g/mol
LogP0.86
Rot. Bonds3

About 2-(5-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid

2-(5-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid (PubChem CID 82346034) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 2-(5-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid.

Molecular Properties

Compound Name2-(5-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid
PubChem CID82346034
Molecular FormulaC12H14N2O4
Molecular Weight250.25 g/mol
Exact Mass250.10
IUPAC Name2-(5-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid
SMILESCCC(C(=O)O)N1C(=O)COc2cccc(N)c21
InChIInChI=1S/C12H14N2O4/c1-2-8(12(16)17)14-10(15)6-18-9-5-3-4-7(13)11(9)14/h3-5,8H,2,6,13H2,1H3,(H,16,17)
InChIKeyAMVJGTBONOBGNZ-UHFFFAOYSA-N
XLogP0.86
TPSA92.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.25
LogP ≤ 50.86
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-(5-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid?
The IUPAC name of 2-(5-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid (CID 82346034) is 2-(5-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid.
What is the SMILES notation for 2-(5-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid?
The canonical SMILES for 2-(5-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid is CCC(C(=O)O)N1C(=O)COc2cccc(N)c21.
What is the InChIKey of 2-(5-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid?
The InChIKey is AMVJGTBONOBGNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O4/c1-2-8(12(16)17)14-10(15)6-18-9-5-3-4-7(13)11(9)14/h3-5,8H,2,6,13H2,1H3,(H,16,17).
What are the key properties of 2-(5-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid?
2-(5-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid has a molecular weight of 250.25 g/mol, XLogP of 0.86, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-amino-3-oxo-1,4-benzoxazin-4-yl)butanoic acid is sourced from PubChem (CID 82346034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).