C17H13F3N2O4 — CID 170748009
7-nitro-4-[1-[3-(trifluoromethyl)phenyl]ethyl]-1,4-benzoxazin-3-one (PubChem CID 170748009) has the molecular formula C17H13F3N2O4 and a molecular weight of 366.30 g/mol. Its IUPAC name is 7-nitro-4-[1-[3-(trifluoromethyl)phenyl]ethyl]-1,4-benzoxazin-3-one.
| Compound Name | 7-nitro-4-[1-[3-(trifluoromethyl)phenyl]ethyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 170748009 |
| Molecular Formula | C17H13F3N2O4 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 7-nitro-4-[1-[3-(trifluoromethyl)phenyl]ethyl]-1,4-benzoxazin-3-one |
| SMILES | CC(c1cccc(C(F)(F)F)c1)N1C(=O)COc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C17H13F3N2O4/c1-10(11-3-2-4-12(7-11)17(18,19)20)21-14-6-5-13(22(24)25)8-15(14)26-9-16(21)23/h2-8,10H,9H2,1H3 |
| InChIKey | LCBMWEPABYSMGW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|