C18H21N3O3 — CID 97088911
N,N-dimethyl-4-[(1S)-1-(3-nitrophenyl)ethyl]-2,3-dihydro-1,4-benzoxazin-7-amine (PubChem CID 97088911) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1S)-1-(3-nitrophenyl)ethyl]-2,3-dihydro-1,4-benzoxazin-7-amine.
| Compound Name | N,N-dimethyl-4-[(1S)-1-(3-nitrophenyl)ethyl]-2,3-dihydro-1,4-benzoxazin-7-amine |
|---|---|
| PubChem CID | 97088911 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N,N-dimethyl-4-[(1S)-1-(3-nitrophenyl)ethyl]-2,3-dihydro-1,4-benzoxazin-7-amine |
| SMILES | C[C@@H](c1cccc([N+](=O)[O-])c1)N1CCOc2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C18H21N3O3/c1-13(14-5-4-6-16(11-14)21(22)23)20-9-10-24-18-12-15(19(2)3)7-8-17(18)20/h4-8,11-13H,9-10H2,1-3H3/t13-/m0/s1 |
| InChIKey | HBKNIKQOHCQNER-ZDUSSCGKSA-N |
| XLogP | 3.62 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|