C17H20N2O4S — CID 9353896
(2Z)-2-(3,3-dimethyl-2-oxobutylidene)-3-[(1S)-1-(3-nitrophenyl)ethyl]-1,3-thiazolidin-4-one (PubChem CID 9353896) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is (2Z)-2-(3,3-dimethyl-2-oxobutylidene)-3-[(1S)-1-(3-nitrophenyl)ethyl]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-2-(3,3-dimethyl-2-oxobutylidene)-3-[(1S)-1-(3-nitrophenyl)ethyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 9353896 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (2Z)-2-(3,3-dimethyl-2-oxobutylidene)-3-[(1S)-1-(3-nitrophenyl)ethyl]-1,3-thiazolidin-4-one |
| SMILES | C[C@@H](c1cccc([N+](=O)[O-])c1)N1C(=O)CS/C1=C\C(=O)C(C)(C)C |
| InChI | InChI=1S/C17H20N2O4S/c1-11(12-6-5-7-13(8-12)19(22)23)18-15(21)10-24-16(18)9-14(20)17(2,3)4/h5-9,11H,10H2,1-4H3/b16-9-/t11-/m0/s1 |
| InChIKey | BIIPWAIAXRRNCF-RCEBRVLHSA-N |
| XLogP | 3.69 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|