C18H15F3N2O3 — CID 170748345
6-nitro-1-[1-[3-(trifluoromethyl)phenyl]ethyl]-3,4-dihydroquinolin-2-one (PubChem CID 170748345) has the molecular formula C18H15F3N2O3 and a molecular weight of 364.32 g/mol. Its IUPAC name is 6-nitro-1-[1-[3-(trifluoromethyl)phenyl]ethyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 6-nitro-1-[1-[3-(trifluoromethyl)phenyl]ethyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 170748345 |
| Molecular Formula | C18H15F3N2O3 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 6-nitro-1-[1-[3-(trifluoromethyl)phenyl]ethyl]-3,4-dihydroquinolin-2-one |
| SMILES | CC(c1cccc(C(F)(F)F)c1)N1C(=O)CCc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C18H15F3N2O3/c1-11(12-3-2-4-14(9-12)18(19,20)21)22-16-7-6-15(23(25)26)10-13(16)5-8-17(22)24/h2-4,6-7,9-11H,5,8H2,1H3 |
| InChIKey | YZCGSLOQZGPQDY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|