C15H19BrN2O3 — CID 65011642
1-[2-(bromomethyl)-3-methylbutyl]-6-nitro-3,4-dihydroquinolin-2-one (PubChem CID 65011642) has the molecular formula C15H19BrN2O3 and a molecular weight of 355.23 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3-methylbutyl]-6-nitro-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[2-(bromomethyl)-3-methylbutyl]-6-nitro-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 65011642 |
| Molecular Formula | C15H19BrN2O3 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 1-[2-(bromomethyl)-3-methylbutyl]-6-nitro-3,4-dihydroquinolin-2-one |
| SMILES | CC(C)C(CBr)CN1C(=O)CCc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C15H19BrN2O3/c1-10(2)12(8-16)9-17-14-5-4-13(18(20)21)7-11(14)3-6-15(17)19/h4-5,7,10,12H,3,6,8-9H2,1-2H3 |
| InChIKey | CCXMLUANJLOJGE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|