C11H9BrN2O4 — CID 129185501
1-[2-(bromomethyl)-4-nitrophenyl]pyrrolidine-2,5-dione (PubChem CID 129185501) has the molecular formula C11H9BrN2O4 and a molecular weight of 313.11 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-4-nitrophenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-(bromomethyl)-4-nitrophenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 129185501 |
| Molecular Formula | C11H9BrN2O4 |
| Molecular Weight | 313.11 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | 1-[2-(bromomethyl)-4-nitrophenyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1c1ccc([N+](=O)[O-])cc1CBr |
| InChI | InChI=1S/C11H9BrN2O4/c12-6-7-5-8(14(17)18)1-2-9(7)13-10(15)3-4-11(13)16/h1-2,5H,3-4,6H2 |
| InChIKey | UQMASKVMKXFDNW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.11 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|