C10H13Br2NO2 — CID 143301979
1,2-bis(bromomethyl)-4-nitrobenzene;ethane (PubChem CID 143301979) has the molecular formula C10H13Br2NO2 and a molecular weight of 339.03 g/mol. Its IUPAC name is 1,2-bis(bromomethyl)-4-nitrobenzene;ethane.
| Compound Name | 1,2-bis(bromomethyl)-4-nitrobenzene;ethane |
|---|---|
| PubChem CID | 143301979 |
| Molecular Formula | C10H13Br2NO2 |
| Molecular Weight | 339.03 g/mol |
| Exact Mass | 336.93 |
| IUPAC Name | 1,2-bis(bromomethyl)-4-nitrobenzene;ethane |
| SMILES | CC.O=[N+]([O-])c1ccc(CBr)c(CBr)c1 |
| InChI | InChI=1S/C8H7Br2NO2.C2H6/c9-4-6-1-2-8(11(12)13)3-7(6)5-10;1-2/h1-3H,4-5H2;1-2H3 |
| InChIKey | WCHWIOXIMCWSDG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.03 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|