C14H16N2O4 — CID 62039969
7-nitro-1-(2-oxobutyl)-4,5-dihydro-3H-1-benzazepin-2-one (PubChem CID 62039969) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 7-nitro-1-(2-oxobutyl)-4,5-dihydro-3H-1-benzazepin-2-one.
| Compound Name | 7-nitro-1-(2-oxobutyl)-4,5-dihydro-3H-1-benzazepin-2-one |
|---|---|
| PubChem CID | 62039969 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 7-nitro-1-(2-oxobutyl)-4,5-dihydro-3H-1-benzazepin-2-one |
| SMILES | CCC(=O)CN1C(=O)CCCc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C14H16N2O4/c1-2-12(17)9-15-13-7-6-11(16(19)20)8-10(13)4-3-5-14(15)18/h6-8H,2-5,9H2,1H3 |
| InChIKey | DEOIIANZTMLWTE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|