C9H10N2O2 — CID 121375479
2-(deuteriomethyl)-5-nitro-1,3-dihydroisoindole (PubChem CID 121375479) has the molecular formula C9H10N2O2 and a molecular weight of 179.20 g/mol. Its IUPAC name is 2-(deuteriomethyl)-5-nitro-1,3-dihydroisoindole.
| Compound Name | 2-(deuteriomethyl)-5-nitro-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 121375479 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 2-(deuteriomethyl)-5-nitro-1,3-dihydroisoindole |
| SMILES | [2H]CN1Cc2ccc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C9H10N2O2/c1-10-5-7-2-3-9(11(12)13)4-8(7)6-10/h2-4H,5-6H2,1H3/i1D |
| InChIKey | KBRUQEDLLNRMKU-MICDWDOJSA-N |
| XLogP | 1.54 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|