C12H15N3O2S — CID 176837849
2-(1-methylsulfanylazetidin-3-yl)-5-nitro-1,3-dihydroisoindole (PubChem CID 176837849) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 2-(1-methylsulfanylazetidin-3-yl)-5-nitro-1,3-dihydroisoindole.
| Compound Name | 2-(1-methylsulfanylazetidin-3-yl)-5-nitro-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 176837849 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-(1-methylsulfanylazetidin-3-yl)-5-nitro-1,3-dihydroisoindole |
| SMILES | CSN1CC(N2Cc3ccc([N+](=O)[O-])cc3C2)C1 |
| InChI | InChI=1S/C12H15N3O2S/c1-18-14-7-12(8-14)13-5-9-2-3-11(15(16)17)4-10(9)6-13/h2-4,12H,5-8H2,1H3 |
| InChIKey | IYTZNEAMJNOQBH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|