C15H20N4O2S2 — CID 177332600
(4-methylsulfanylpiperazin-1-yl)-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methanethione (PubChem CID 177332600) has the molecular formula C15H20N4O2S2 and a molecular weight of 352.49 g/mol. Its IUPAC name is (4-methylsulfanylpiperazin-1-yl)-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methanethione.
| Compound Name | (4-methylsulfanylpiperazin-1-yl)-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methanethione |
|---|---|
| PubChem CID | 177332600 |
| Molecular Formula | C15H20N4O2S2 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | (4-methylsulfanylpiperazin-1-yl)-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)methanethione |
| SMILES | CSN1CCN(C(=S)N2CCc3ccc([N+](=O)[O-])cc3C2)CC1 |
| InChI | InChI=1S/C15H20N4O2S2/c1-23-18-8-6-16(7-9-18)15(22)17-5-4-12-2-3-14(19(20)21)10-13(12)11-17/h2-3,10H,4-9,11H2,1H3 |
| InChIKey | ORBXLYYGTAFTKI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|