C9H11ClN2O2 — CID 56972107
(2S)-5-nitro-2,3-dihydro-1H-inden-2-amine;hydrochloride (PubChem CID 56972107) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is (2S)-5-nitro-2,3-dihydro-1H-inden-2-amine;hydrochloride.
| Compound Name | (2S)-5-nitro-2,3-dihydro-1H-inden-2-amine;hydrochloride |
|---|---|
| PubChem CID | 56972107 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | (2S)-5-nitro-2,3-dihydro-1H-inden-2-amine;hydrochloride |
| SMILES | Cl.N[C@H]1Cc2ccc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C9H10N2O2.ClH/c10-8-3-6-1-2-9(11(12)13)5-7(6)4-8;/h1-2,5,8H,3-4,10H2;1H/t8-;/m0./s1 |
| InChIKey | FFGLVSGGGJOMQY-QRPNPIFTSA-N |
| XLogP | 1.44 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|