C10H13ClN2O2 — CID 23298420
7-nitro-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride (PubChem CID 23298420) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is 7-nitro-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride.
| Compound Name | 7-nitro-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride |
|---|---|
| PubChem CID | 23298420 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 7-nitro-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride |
| SMILES | Cl.NC1CCc2ccc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C10H12N2O2.ClH/c11-9-3-1-7-2-4-10(12(13)14)6-8(7)5-9;/h2,4,6,9H,1,3,5,11H2;1H |
| InChIKey | DAYRGFHXWCSBQP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|