C11H11NO4 — CID 86114706
6-nitro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid (PubChem CID 86114706) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 6-nitro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid.
| Compound Name | 6-nitro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 86114706 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 6-nitro-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
| SMILES | O=C(O)C1CCc2cc([N+](=O)[O-])ccc2C1 |
| InChI | InChI=1S/C11H11NO4/c13-11(14)9-2-1-8-6-10(12(15)16)4-3-7(8)5-9/h3-4,6,9H,1-2,5H2,(H,13,14) |
| InChIKey | BPDCTVFBGBMRJS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|