C9H10N2O2 — CID 55278481
(1R)-6-nitro-2,3-dihydro-1H-inden-1-amine (PubChem CID 55278481) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is (1R)-6-nitro-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1R)-6-nitro-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 55278481 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | (1R)-6-nitro-2,3-dihydro-1H-inden-1-amine |
| SMILES | N[C@@H]1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C9H10N2O2/c10-9-4-2-6-1-3-7(11(12)13)5-8(6)9/h1,3,5,9H,2,4,10H2/t9-/m1/s1 |
| InChIKey | ROSHRXGQJBKFEG-SECBINFHSA-N |
| XLogP | 1.54 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|