C11H14N2O2 — CID 19365901
3,3-dimethyl-6-nitro-1,2-dihydroinden-1-amine (PubChem CID 19365901) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 3,3-dimethyl-6-nitro-1,2-dihydroinden-1-amine.
| Compound Name | 3,3-dimethyl-6-nitro-1,2-dihydroinden-1-amine |
|---|---|
| PubChem CID | 19365901 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 3,3-dimethyl-6-nitro-1,2-dihydroinden-1-amine |
| SMILES | CC1(C)CC(N)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C11H14N2O2/c1-11(2)6-10(12)8-5-7(13(14)15)3-4-9(8)11/h3-5,10H,6,12H2,1-2H3 |
| InChIKey | RXVBSXNZBHJPBT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|