C11H11NO3 — CID 14896382
6,6-dimethyl-3-nitro-1a,6a-dihydroindeno[1,2-b]oxirene (PubChem CID 14896382) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 6,6-dimethyl-3-nitro-1a,6a-dihydroindeno[1,2-b]oxirene.
| Compound Name | 6,6-dimethyl-3-nitro-1a,6a-dihydroindeno[1,2-b]oxirene |
|---|---|
| PubChem CID | 14896382 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 6,6-dimethyl-3-nitro-1a,6a-dihydroindeno[1,2-b]oxirene |
| SMILES | CC1(C)c2ccc([N+](=O)[O-])cc2C2OC21 |
| InChI | InChI=1S/C11H11NO3/c1-11(2)8-4-3-6(12(13)14)5-7(8)9-10(11)15-9/h3-5,9-10H,1-2H3 |
| InChIKey | QEVFLVRVNBIPLV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|