C14H15NO4 — CID 129405569
(1aR,7bS)-6-nitrospiro[1a,7b-dihydrooxireno[2,3-c]chromene-2,1'-cyclohexane] (PubChem CID 129405569) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is (1aR,7bS)-6-nitrospiro[1a,7b-dihydrooxireno[2,3-c]chromene-2,1'-cyclohexane].
| Compound Name | (1aR,7bS)-6-nitrospiro[1a,7b-dihydrooxireno[2,3-c]chromene-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 129405569 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (1aR,7bS)-6-nitrospiro[1a,7b-dihydrooxireno[2,3-c]chromene-2,1'-cyclohexane] |
| SMILES | O=[N+]([O-])c1ccc2c(c1)[C@@H]1O[C@H]1C1(CCCCC1)O2 |
| InChI | InChI=1S/C14H15NO4/c16-15(17)9-4-5-11-10(8-9)12-13(18-12)14(19-11)6-2-1-3-7-14/h4-5,8,12-13H,1-3,6-7H2/t12-,13+/m0/s1 |
| InChIKey | MCKXJUFFKKLREJ-QWHCGFSZSA-N |
| XLogP | 3.13 |
| TPSA | 64.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|