C12H16N2O4 — CID 54298060
(3R,4S)-2,2-dimethyl-4-(methylamino)-6-nitro-3,4-dihydrochromen-3-ol (PubChem CID 54298060) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is (3R,4S)-2,2-dimethyl-4-(methylamino)-6-nitro-3,4-dihydrochromen-3-ol.
| Compound Name | (3R,4S)-2,2-dimethyl-4-(methylamino)-6-nitro-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 54298060 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (3R,4S)-2,2-dimethyl-4-(methylamino)-6-nitro-3,4-dihydrochromen-3-ol |
| SMILES | CN[C@H]1c2cc([N+](=O)[O-])ccc2OC(C)(C)[C@@H]1O |
| InChI | InChI=1S/C12H16N2O4/c1-12(2)11(15)10(13-3)8-6-7(14(16)17)4-5-9(8)18-12/h4-6,10-11,13,15H,1-3H3/t10-,11+/m0/s1 |
| InChIKey | SCEIQCQDRSFBCU-WDEREUQCSA-N |
| XLogP | 1.39 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|