C17H24N2O4 — CID 70617911
(3S,4R)-4-(2,4-dimethylpyrrolidin-1-yl)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol (PubChem CID 70617911) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is (3S,4R)-4-(2,4-dimethylpyrrolidin-1-yl)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol.
| Compound Name | (3S,4R)-4-(2,4-dimethylpyrrolidin-1-yl)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 70617911 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (3S,4R)-4-(2,4-dimethylpyrrolidin-1-yl)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol |
| SMILES | CC1CC(C)N([C@@H]2c3cc([N+](=O)[O-])ccc3OC(C)(C)[C@H]2O)C1 |
| InChI | InChI=1S/C17H24N2O4/c1-10-7-11(2)18(9-10)15-13-8-12(19(21)22)5-6-14(13)23-17(3,4)16(15)20/h5-6,8,10-11,15-16,20H,7,9H2,1-4H3/t10?,11?,15-,16+/m1/s1 |
| InChIKey | STPWCTQMFIAARZ-DETCHVMESA-N |
| XLogP | 2.90 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|