C15H19N3O6 — CID 18645510
N'-acetyl-N'-[(3R,4S)-3-hydroxy-2,2-dimethyl-6-nitro-3,4-dihydrochromen-4-yl]acetohydrazide (PubChem CID 18645510) has the molecular formula C15H19N3O6 and a molecular weight of 337.33 g/mol. Its IUPAC name is N'-acetyl-N'-[(3R,4S)-3-hydroxy-2,2-dimethyl-6-nitro-3,4-dihydrochromen-4-yl]acetohydrazide.
| Compound Name | N'-acetyl-N'-[(3R,4S)-3-hydroxy-2,2-dimethyl-6-nitro-3,4-dihydrochromen-4-yl]acetohydrazide |
|---|---|
| PubChem CID | 18645510 |
| Molecular Formula | C15H19N3O6 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N'-acetyl-N'-[(3R,4S)-3-hydroxy-2,2-dimethyl-6-nitro-3,4-dihydrochromen-4-yl]acetohydrazide |
| SMILES | CC(=O)NN(C(C)=O)[C@H]1c2cc([N+](=O)[O-])ccc2OC(C)(C)[C@@H]1O |
| InChI | InChI=1S/C15H19N3O6/c1-8(19)16-17(9(2)20)13-11-7-10(18(22)23)5-6-12(11)24-15(3,4)14(13)21/h5-7,13-14,21H,1-4H3,(H,16,19)/t13-,14+/m0/s1 |
| InChIKey | FVCKSADRKVBTSE-UONOGXRCSA-N |
| XLogP | 1.07 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|