C16H26N2O7S — CID 13222945
(3S,4R)-4-(tert-butylamino)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol;methanesulfonic acid (PubChem CID 13222945) has the molecular formula C16H26N2O7S and a molecular weight of 390.46 g/mol. Its IUPAC name is (3S,4R)-4-(tert-butylamino)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol;methanesulfonic acid.
| Compound Name | (3S,4R)-4-(tert-butylamino)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol;methanesulfonic acid |
|---|---|
| PubChem CID | 13222945 |
| Molecular Formula | C16H26N2O7S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (3S,4R)-4-(tert-butylamino)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol;methanesulfonic acid |
| SMILES | CC(C)(C)N[C@@H]1c2cc([N+](=O)[O-])ccc2OC(C)(C)[C@H]1O.CS(=O)(=O)O |
| InChI | InChI=1S/C15H22N2O4.CH4O3S/c1-14(2,3)16-12-10-8-9(17(19)20)6-7-11(10)21-15(4,5)13(12)18;1-5(2,3)4/h6-8,12-13,16,18H,1-5H3;1H3,(H,2,3,4)/t12-,13+;/m1./s1 |
| InChIKey | VOYPSKOJSPLKOZ-KZCZEQIWSA-N |
| XLogP | 2.06 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|