C21H28N2O7 — CID 154149260
3-[3-[[(3S,4R)-3-hydroxy-2,2-dimethyl-6-nitro-3,4-dihydrochromen-4-yl]amino]-2-[(2-methylpropan-2-yl)oxy]prop-2-enoxy]prop-1-en-1-one (PubChem CID 154149260) has the molecular formula C21H28N2O7 and a molecular weight of 420.46 g/mol. Its IUPAC name is 3-[3-[[(3S,4R)-3-hydroxy-2,2-dimethyl-6-nitro-3,4-dihydrochromen-4-yl]amino]-2-[(2-methylpropan-2-yl)oxy]prop-2-enoxy]prop-1-en-1-one.
| Compound Name | 3-[3-[[(3S,4R)-3-hydroxy-2,2-dimethyl-6-nitro-3,4-dihydrochromen-4-yl]amino]-2-[(2-methylpropan-2-yl)oxy]prop-2-enoxy]prop-1-en-1-one |
|---|---|
| PubChem CID | 154149260 |
| Molecular Formula | C21H28N2O7 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 3-[3-[[(3S,4R)-3-hydroxy-2,2-dimethyl-6-nitro-3,4-dihydrochromen-4-yl]amino]-2-[(2-methylpropan-2-yl)oxy]prop-2-enoxy]prop-1-en-1-one |
| SMILES | CC(C)(C)OC(=CN[C@@H]1c2cc([N+](=O)[O-])ccc2OC(C)(C)[C@H]1O)COCC=C=O |
| InChI | InChI=1S/C21H28N2O7/c1-20(2,3)29-15(13-28-10-6-9-24)12-22-18-16-11-14(23(26)27)7-8-17(16)30-21(4,5)19(18)25/h6-8,11-12,18-19,22,25H,10,13H2,1-5H3/t18-,19+/m1/s1 |
| InChIKey | ZGPDKFSPNHPROQ-MOPGFXCFSA-N |
| XLogP | 2.82 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|