C26H36N2O5 — CID 88512547
(3R,4S)-2,2-dibutyl-4-[[(E)-2-ethoxy-3-(3-oxoprop-2-enoxy)prop-1-enyl]amino]-3-hydroxy-3,4-dihydrochromene-6-carbonitrile (PubChem CID 88512547) has the molecular formula C26H36N2O5 and a molecular weight of 456.58 g/mol. Its IUPAC name is (3R,4S)-2,2-dibutyl-4-[[(E)-2-ethoxy-3-(3-oxoprop-2-enoxy)prop-1-enyl]amino]-3-hydroxy-3,4-dihydrochromene-6-carbonitrile.
| Compound Name | (3R,4S)-2,2-dibutyl-4-[[(E)-2-ethoxy-3-(3-oxoprop-2-enoxy)prop-1-enyl]amino]-3-hydroxy-3,4-dihydrochromene-6-carbonitrile |
|---|---|
| PubChem CID | 88512547 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | (3R,4S)-2,2-dibutyl-4-[[(E)-2-ethoxy-3-(3-oxoprop-2-enoxy)prop-1-enyl]amino]-3-hydroxy-3,4-dihydrochromene-6-carbonitrile |
| SMILES | CCCCC1(CCCC)Oc2ccc(C#N)cc2[C@H](N/C=C(\COCC=C=O)OCC)[C@H]1O |
| InChI | InChI=1S/C26H36N2O5/c1-4-7-12-26(13-8-5-2)25(30)24(22-16-20(17-27)10-11-23(22)33-26)28-18-21(32-6-3)19-31-15-9-14-29/h9-11,16,18,24-25,28,30H,4-8,12-13,15,19H2,1-3H3/b21-18+/t24-,25+/m0/s1 |
| InChIKey | WEVFPEAODNWRFF-KYHUYVFASA-N |
| XLogP | 4.34 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|