C20H24N2O5 — CID 88512468
(3R,4S)-2,2-diethyl-3-hydroxy-4-[[(E)-2-methoxy-3-(2-oxoethenoxy)prop-1-enyl]amino]-3,4-dihydrochromene-6-carbonitrile (PubChem CID 88512468) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is (3R,4S)-2,2-diethyl-3-hydroxy-4-[[(E)-2-methoxy-3-(2-oxoethenoxy)prop-1-enyl]amino]-3,4-dihydrochromene-6-carbonitrile.
| Compound Name | (3R,4S)-2,2-diethyl-3-hydroxy-4-[[(E)-2-methoxy-3-(2-oxoethenoxy)prop-1-enyl]amino]-3,4-dihydrochromene-6-carbonitrile |
|---|---|
| PubChem CID | 88512468 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (3R,4S)-2,2-diethyl-3-hydroxy-4-[[(E)-2-methoxy-3-(2-oxoethenoxy)prop-1-enyl]amino]-3,4-dihydrochromene-6-carbonitrile |
| SMILES | CCC1(CC)Oc2ccc(C#N)cc2[C@H](N/C=C(\COC=C=O)OC)[C@H]1O |
| InChI | InChI=1S/C20H24N2O5/c1-4-20(5-2)19(24)18(22-12-15(25-3)13-26-9-8-23)16-10-14(11-21)6-7-17(16)27-20/h6-7,9-10,12,18-19,22,24H,4-5,13H2,1-3H3/b15-12+/t18-,19+/m0/s1 |
| InChIKey | YUMDNWGSIMLBCZ-MVVBNGQASA-N |
| XLogP | 2.35 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|