C25H36N2O7 — CID 173372542
3-[3-[[(3S,4R)-2,2-diethyl-3-hydroxy-6-nitro-3,4-dihydrochromen-4-yl]amino]-2-hexoxyprop-2-enoxy]prop-1-en-1-one (PubChem CID 173372542) has the molecular formula C25H36N2O7 and a molecular weight of 476.57 g/mol. Its IUPAC name is 3-[3-[[(3S,4R)-2,2-diethyl-3-hydroxy-6-nitro-3,4-dihydrochromen-4-yl]amino]-2-hexoxyprop-2-enoxy]prop-1-en-1-one.
| Compound Name | 3-[3-[[(3S,4R)-2,2-diethyl-3-hydroxy-6-nitro-3,4-dihydrochromen-4-yl]amino]-2-hexoxyprop-2-enoxy]prop-1-en-1-one |
|---|---|
| PubChem CID | 173372542 |
| Molecular Formula | C25H36N2O7 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 3-[3-[[(3S,4R)-2,2-diethyl-3-hydroxy-6-nitro-3,4-dihydrochromen-4-yl]amino]-2-hexoxyprop-2-enoxy]prop-1-en-1-one |
| SMILES | CCCCCCOC(=CN[C@@H]1c2cc([N+](=O)[O-])ccc2OC(CC)(CC)[C@H]1O)COCC=C=O |
| InChI | InChI=1S/C25H36N2O7/c1-4-7-8-9-15-33-20(18-32-14-10-13-28)17-26-23-21-16-19(27(30)31)11-12-22(21)34-25(5-2,6-3)24(23)29/h10-12,16-17,23-24,26,29H,4-9,14-15,18H2,1-3H3/t23-,24+/m1/s1 |
| InChIKey | JZBDPSFYVRBOBG-RPWUZVMVSA-N |
| XLogP | 4.38 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|