C17H23NO4 — CID 19982682
2,2-dibutyl-6-nitro-1a,7b-dihydrooxireno[2,3-c]chromene (PubChem CID 19982682) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 2,2-dibutyl-6-nitro-1a,7b-dihydrooxireno[2,3-c]chromene.
| Compound Name | 2,2-dibutyl-6-nitro-1a,7b-dihydrooxireno[2,3-c]chromene |
|---|---|
| PubChem CID | 19982682 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2,2-dibutyl-6-nitro-1a,7b-dihydrooxireno[2,3-c]chromene |
| SMILES | CCCCC1(CCCC)Oc2ccc([N+](=O)[O-])cc2C2OC21 |
| InChI | InChI=1S/C17H23NO4/c1-3-5-9-17(10-6-4-2)16-15(21-16)13-11-12(18(19)20)7-8-14(13)22-17/h7-8,11,15-16H,3-6,9-10H2,1-2H3 |
| InChIKey | RLDQMVMLAWVOPB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|