C12H13NO5 — CID 87740902
(1aR,2R,7bR)-2-(methoxymethyl)-2-methyl-6-nitro-1a,7b-dihydrooxireno[2,3-c]chromene (PubChem CID 87740902) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is (1aR,2R,7bR)-2-(methoxymethyl)-2-methyl-6-nitro-1a,7b-dihydrooxireno[2,3-c]chromene.
| Compound Name | (1aR,2R,7bR)-2-(methoxymethyl)-2-methyl-6-nitro-1a,7b-dihydrooxireno[2,3-c]chromene |
|---|---|
| PubChem CID | 87740902 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | (1aR,2R,7bR)-2-(methoxymethyl)-2-methyl-6-nitro-1a,7b-dihydrooxireno[2,3-c]chromene |
| SMILES | COC[C@@]1(C)Oc2ccc([N+](=O)[O-])cc2[C@H]2O[C@H]21 |
| InChI | InChI=1S/C12H13NO5/c1-12(6-16-2)11-10(17-11)8-5-7(13(14)15)3-4-9(8)18-12/h3-5,10-11H,6H2,1-2H3/t10-,11-,12-/m1/s1 |
| InChIKey | GBPRQFXAMSDDRT-IJLUTSLNSA-N |
| XLogP | 1.83 |
| TPSA | 74.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|