C19H17ClN2O6S — CID 11224372
5-chloro-3-[(2S,3R,4R)-3-hydroxy-2-(methoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-1,3-benzoxazole-2-thione (PubChem CID 11224372) has the molecular formula C19H17ClN2O6S and a molecular weight of 436.87 g/mol. Its IUPAC name is 5-chloro-3-[(2S,3R,4R)-3-hydroxy-2-(methoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-1,3-benzoxazole-2-thione.
| Compound Name | 5-chloro-3-[(2S,3R,4R)-3-hydroxy-2-(methoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-1,3-benzoxazole-2-thione |
|---|---|
| PubChem CID | 11224372 |
| Molecular Formula | C19H17ClN2O6S |
| Molecular Weight | 436.87 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 5-chloro-3-[(2S,3R,4R)-3-hydroxy-2-(methoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]-1,3-benzoxazole-2-thione |
| SMILES | COC[C@]1(C)Oc2ccc([N+](=O)[O-])cc2[C@@H](n2c(=S)oc3ccc(Cl)cc32)[C@H]1O |
| InChI | InChI=1S/C19H17ClN2O6S/c1-19(9-26-2)17(23)16(12-8-11(22(24)25)4-6-14(12)28-19)21-13-7-10(20)3-5-15(13)27-18(21)29/h3-8,16-17,23H,9H2,1-2H3/t16-,17-,19+/m1/s1 |
| InChIKey | KCWUMTLAIHTJSB-LMMKCTJWSA-N |
| XLogP | 4.27 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.87 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|