C22H22N2O9 — CID 68567876
[1-[(2S,3S,4R)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]indol-2-yl] hydrogen carbonate (PubChem CID 68567876) has the molecular formula C22H22N2O9 and a molecular weight of 458.42 g/mol. Its IUPAC name is [1-[(2S,3S,4R)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]indol-2-yl] hydrogen carbonate.
| Compound Name | [1-[(2S,3S,4R)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 68567876 |
| Molecular Formula | C22H22N2O9 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | [1-[(2S,3S,4R)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]indol-2-yl] hydrogen carbonate |
| SMILES | COC(OC)[C@@]1(C)Oc2ccc([N+](=O)[O-])cc2[C@@H](n2c(OC(=O)O)cc3ccccc32)[C@@H]1O |
| InChI | InChI=1S/C22H22N2O9/c1-22(20(30-2)31-3)19(25)18(14-11-13(24(28)29)8-9-16(14)33-22)23-15-7-5-4-6-12(15)10-17(23)32-21(26)27/h4-11,18-20,25H,1-3H3,(H,26,27)/t18-,19+,22+/m1/s1 |
| InChIKey | BTGOGEONARQOFV-DXIQSLLYSA-N |
| XLogP | 3.33 |
| TPSA | 142.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|